C16H12BN3O — CID 154652808
CID 154652808 (PubChem CID 154652808) has the molecular formula C16H12BN3O and a molecular weight of 273.10 g/mol.
| Compound Name | CID 154652808 |
|---|---|
| PubChem CID | 154652808 |
| Molecular Formula | C16H12BN3O |
| Molecular Weight | 273.10 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)Nc2ccn(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H12BN3O/c17-13-8-6-12(7-9-13)16(21)18-15-10-11-20(19-15)14-4-2-1-3-5-14/h1-11H,(H,18,19,21) |
| InChIKey | QRHGSYQRBFYAOA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.10 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|