C24H22N4O3S — CID 55537355
4-[(3,4-dimethylphenyl)sulfamoyl]-N-(1-phenylpyrazol-3-yl)benzamide (PubChem CID 55537355) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)sulfamoyl]-N-(1-phenylpyrazol-3-yl)benzamide.
| Compound Name | 4-[(3,4-dimethylphenyl)sulfamoyl]-N-(1-phenylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 55537355 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)sulfamoyl]-N-(1-phenylpyrazol-3-yl)benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)Nc3ccn(-c4ccccc4)n3)cc2)cc1C |
| InChI | InChI=1S/C24H22N4O3S/c1-17-8-11-20(16-18(17)2)27-32(30,31)22-12-9-19(10-13-22)24(29)25-23-14-15-28(26-23)21-6-4-3-5-7-21/h3-16,27H,1-2H3,(H,25,26,29) |
| InChIKey | BEAMTAMQSKMSCG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |