C21H21ClN4O3 — CID 55710568
4-[(E)-3-[3-chloro-4-(3-oxopiperazin-1-yl)anilino]-3-oxoprop-1-enyl]-N-methylbenzamide (PubChem CID 55710568) has the molecular formula C21H21ClN4O3 and a molecular weight of 412.88 g/mol. Its IUPAC name is 4-[(E)-3-[3-chloro-4-(3-oxopiperazin-1-yl)anilino]-3-oxoprop-1-enyl]-N-methylbenzamide.
| Compound Name | 4-[(E)-3-[3-chloro-4-(3-oxopiperazin-1-yl)anilino]-3-oxoprop-1-enyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 55710568 |
| Molecular Formula | C21H21ClN4O3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-[(E)-3-[3-chloro-4-(3-oxopiperazin-1-yl)anilino]-3-oxoprop-1-enyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)Nc2ccc(N3CCNC(=O)C3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H21ClN4O3/c1-23-21(29)15-5-2-14(3-6-15)4-9-19(27)25-16-7-8-18(17(22)12-16)26-11-10-24-20(28)13-26/h2-9,12H,10-11,13H2,1H3,(H,23,29)(H,24,28)(H,25,27)/b9-4+ |
| InChIKey | ZDKDPIOUIAGFRU-RUDMXATFSA-N |
| XLogP | 2.29 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|