C19H23N3O4S — CID 51276353
methyl 4-methyl-2-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)amino]pentanoate (PubChem CID 51276353) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is methyl 4-methyl-2-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)amino]pentanoate.
| Compound Name | methyl 4-methyl-2-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 51276353 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl 4-methyl-2-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)amino]pentanoate |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)NC(CC(C)C)C(=O)OC)ccc2c1=O |
| InChI | InChI=1S/C19H23N3O4S/c1-5-8-22-17(24)13-7-6-12(10-14(13)21-19(22)27)16(23)20-15(9-11(2)3)18(25)26-4/h5-7,10-11,15H,1,8-9H2,2-4H3,(H,20,23)(H,21,27) |
| InChIKey | FDALCXALTXULRH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|