C26H31ClFN3O2S — CID 92505371
4-[(2-chloro-6-fluorophenyl)methyl]-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 92505371) has the molecular formula C26H31ClFN3O2S and a molecular weight of 504.07 g/mol. Its IUPAC name is 4-[(2-chloro-6-fluorophenyl)methyl]-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | 4-[(2-chloro-6-fluorophenyl)methyl]-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 92505371 |
| Molecular Formula | C26H31ClFN3O2S |
| Molecular Weight | 504.07 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methyl]-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | CC[C@H]1CCCCN1CCCNC(=O)c1ccc2c(c1)N(Cc1c(F)cccc1Cl)C(=O)CS2 |
| InChI | InChI=1S/C26H31ClFN3O2S/c1-2-19-7-3-4-13-30(19)14-6-12-29-26(33)18-10-11-24-23(15-18)31(25(32)17-34-24)16-20-21(27)8-5-9-22(20)28/h5,8-11,15,19H,2-4,6-7,12-14,16-17H2,1H3,(H,29,33)/t19-/m0/s1 |
| InChIKey | QSDARQQTABAUDJ-IBGZPJMESA-N |
| XLogP | 5.50 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.07 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|