C26H32BrN3O2 — CID 90800740
2-[(4-bromophenyl)methyl]-N-[3-(2-ethylpiperidin-1-yl)propyl]-3-hydroxyisoindole-5-carboxamide (PubChem CID 90800740) has the molecular formula C26H32BrN3O2 and a molecular weight of 498.47 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-N-[3-(2-ethylpiperidin-1-yl)propyl]-3-hydroxyisoindole-5-carboxamide.
| Compound Name | 2-[(4-bromophenyl)methyl]-N-[3-(2-ethylpiperidin-1-yl)propyl]-3-hydroxyisoindole-5-carboxamide |
|---|---|
| PubChem CID | 90800740 |
| Molecular Formula | C26H32BrN3O2 |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-N-[3-(2-ethylpiperidin-1-yl)propyl]-3-hydroxyisoindole-5-carboxamide |
| SMILES | CCC1CCCCN1CCCNC(=O)c1ccc2cn(Cc3ccc(Br)cc3)c(O)c2c1 |
| InChI | InChI=1S/C26H32BrN3O2/c1-2-23-6-3-4-14-29(23)15-5-13-28-25(31)20-9-10-21-18-30(26(32)24(21)16-20)17-19-7-11-22(27)12-8-19/h7-12,16,18,23,32H,2-6,13-15,17H2,1H3,(H,28,31) |
| InChIKey | YVEISCCZTKKRBB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|