C27H34ClN3O2 — CID 91578503
2-[(3-chlorophenyl)methyl]-3-hydroxy-N-[3-(2-propan-2-ylpiperidin-1-yl)propyl]isoindole-5-carboxamide (PubChem CID 91578503) has the molecular formula C27H34ClN3O2 and a molecular weight of 468.04 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-3-hydroxy-N-[3-(2-propan-2-ylpiperidin-1-yl)propyl]isoindole-5-carboxamide.
| Compound Name | 2-[(3-chlorophenyl)methyl]-3-hydroxy-N-[3-(2-propan-2-ylpiperidin-1-yl)propyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 91578503 |
| Molecular Formula | C27H34ClN3O2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-3-hydroxy-N-[3-(2-propan-2-ylpiperidin-1-yl)propyl]isoindole-5-carboxamide |
| SMILES | CC(C)C1CCCCN1CCCNC(=O)c1ccc2cn(Cc3cccc(Cl)c3)c(O)c2c1 |
| InChI | InChI=1S/C27H34ClN3O2/c1-19(2)25-9-3-4-13-30(25)14-6-12-29-26(32)21-10-11-22-18-31(27(33)24(22)16-21)17-20-7-5-8-23(28)15-20/h5,7-8,10-11,15-16,18-19,25,33H,3-4,6,9,12-14,17H2,1-2H3,(H,29,32) |
| InChIKey | MAPBIVRROQYLLC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|