C30H43N3O2 — CID 143924112
ethane;2-[(4-methylphenyl)methyl]-3-oxo-N-[3-(2-propan-2-ylpiperidin-1-yl)propyl]-1H-isoindole-5-carboxamide (PubChem CID 143924112) has the molecular formula C30H43N3O2 and a molecular weight of 477.69 g/mol. Its IUPAC name is ethane;2-[(4-methylphenyl)methyl]-3-oxo-N-[3-(2-propan-2-ylpiperidin-1-yl)propyl]-1H-isoindole-5-carboxamide.
| Compound Name | ethane;2-[(4-methylphenyl)methyl]-3-oxo-N-[3-(2-propan-2-ylpiperidin-1-yl)propyl]-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 143924112 |
| Molecular Formula | C30H43N3O2 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.34 |
| IUPAC Name | ethane;2-[(4-methylphenyl)methyl]-3-oxo-N-[3-(2-propan-2-ylpiperidin-1-yl)propyl]-1H-isoindole-5-carboxamide |
| SMILES | CC.Cc1ccc(CN2Cc3ccc(C(=O)NCCCN4CCCCC4C(C)C)cc3C2=O)cc1 |
| InChI | InChI=1S/C28H37N3O2.C2H6/c1-20(2)26-7-4-5-15-30(26)16-6-14-29-27(32)23-12-13-24-19-31(28(33)25(24)17-23)18-22-10-8-21(3)9-11-22;1-2/h8-13,17,20,26H,4-7,14-16,18-19H2,1-3H3,(H,29,32);1-2H3 |
| InChIKey | IRMOUJJMCBFEOQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|