C32H44FN3O — CID 142385476
6-[1-[3-(2-butylpiperidin-1-yl)propylamino]ethenyl]-2-[(4-fluorophenyl)methyl]-3H-isoindol-1-one;prop-1-ene (PubChem CID 142385476) has the molecular formula C32H44FN3O and a molecular weight of 505.72 g/mol. Its IUPAC name is 6-[1-[3-(2-butylpiperidin-1-yl)propylamino]ethenyl]-2-[(4-fluorophenyl)methyl]-3H-isoindol-1-one;prop-1-ene.
| Compound Name | 6-[1-[3-(2-butylpiperidin-1-yl)propylamino]ethenyl]-2-[(4-fluorophenyl)methyl]-3H-isoindol-1-one;prop-1-ene |
|---|---|
| PubChem CID | 142385476 |
| Molecular Formula | C32H44FN3O |
| Molecular Weight | 505.72 g/mol |
| Exact Mass | 505.35 |
| IUPAC Name | 6-[1-[3-(2-butylpiperidin-1-yl)propylamino]ethenyl]-2-[(4-fluorophenyl)methyl]-3H-isoindol-1-one;prop-1-ene |
| SMILES | C=C(NCCCN1CCCCC1CCCC)c1ccc2c(c1)C(=O)N(Cc1ccc(F)cc1)C2.C=CC |
| InChI | InChI=1S/C29H38FN3O.C3H6/c1-3-4-8-27-9-5-6-17-32(27)18-7-16-31-22(2)24-12-13-25-21-33(29(34)28(25)19-24)20-23-10-14-26(30)15-11-23;1-3-2/h10-15,19,27,31H,2-9,16-18,20-21H2,1H3;3H,1H2,2H3 |
| InChIKey | RCYIJTJSKQRYRH-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.72 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|