C28H36IN3O2 — CID 68563915
1-[3-(2-butylpiperidin-1-yl)propyl]-2-[(4-iodophenyl)methyl]-3-oxo-1H-isoindole-5-carboxamide (PubChem CID 68563915) has the molecular formula C28H36IN3O2 and a molecular weight of 573.52 g/mol. Its IUPAC name is 1-[3-(2-butylpiperidin-1-yl)propyl]-2-[(4-iodophenyl)methyl]-3-oxo-1H-isoindole-5-carboxamide.
| Compound Name | 1-[3-(2-butylpiperidin-1-yl)propyl]-2-[(4-iodophenyl)methyl]-3-oxo-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 68563915 |
| Molecular Formula | C28H36IN3O2 |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 1-[3-(2-butylpiperidin-1-yl)propyl]-2-[(4-iodophenyl)methyl]-3-oxo-1H-isoindole-5-carboxamide |
| SMILES | CCCCC1CCCCN1CCCC1c2ccc(C(N)=O)cc2C(=O)N1Cc1ccc(I)cc1 |
| InChI | InChI=1S/C28H36IN3O2/c1-2-3-7-23-8-4-5-16-31(23)17-6-9-26-24-15-12-21(27(30)33)18-25(24)28(34)32(26)19-20-10-13-22(29)14-11-20/h10-15,18,23,26H,2-9,16-17,19H2,1H3,(H2,30,33) |
| InChIKey | ICOHFXFGYDXVPC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|