C29H37FN2O2 — CID 159649136
6-[5-(2-butylpiperidin-1-yl)pentanoyl]-2-[(4-fluorophenyl)methyl]-3H-isoindol-1-one (PubChem CID 159649136) has the molecular formula C29H37FN2O2 and a molecular weight of 464.63 g/mol. Its IUPAC name is 6-[5-(2-butylpiperidin-1-yl)pentanoyl]-2-[(4-fluorophenyl)methyl]-3H-isoindol-1-one.
| Compound Name | 6-[5-(2-butylpiperidin-1-yl)pentanoyl]-2-[(4-fluorophenyl)methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 159649136 |
| Molecular Formula | C29H37FN2O2 |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 6-[5-(2-butylpiperidin-1-yl)pentanoyl]-2-[(4-fluorophenyl)methyl]-3H-isoindol-1-one |
| SMILES | CCCCC1CCCCN1CCCCC(=O)c1ccc2c(c1)C(=O)N(Cc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C29H37FN2O2/c1-2-3-8-26-9-4-6-17-31(26)18-7-5-10-28(33)23-13-14-24-21-32(29(34)27(24)19-23)20-22-11-15-25(30)16-12-22/h11-16,19,26H,2-10,17-18,20-21H2,1H3 |
| InChIKey | MRINHUXKUHKAKJ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|