C28H36IN3O — CID 89110444
2-[(4-iodophenyl)methyl]-6-[1-[3-(2-propan-2-ylpiperidin-1-yl)propylamino]ethenyl]-3H-isoindol-1-one (PubChem CID 89110444) has the molecular formula C28H36IN3O and a molecular weight of 557.52 g/mol. Its IUPAC name is 2-[(4-iodophenyl)methyl]-6-[1-[3-(2-propan-2-ylpiperidin-1-yl)propylamino]ethenyl]-3H-isoindol-1-one.
| Compound Name | 2-[(4-iodophenyl)methyl]-6-[1-[3-(2-propan-2-ylpiperidin-1-yl)propylamino]ethenyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 89110444 |
| Molecular Formula | C28H36IN3O |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | 2-[(4-iodophenyl)methyl]-6-[1-[3-(2-propan-2-ylpiperidin-1-yl)propylamino]ethenyl]-3H-isoindol-1-one |
| SMILES | C=C(NCCCN1CCCCC1C(C)C)c1ccc2c(c1)C(=O)N(Cc1ccc(I)cc1)C2 |
| InChI | InChI=1S/C28H36IN3O/c1-20(2)27-7-4-5-15-31(27)16-6-14-30-21(3)23-10-11-24-19-32(28(33)26(24)17-23)18-22-8-12-25(29)13-9-22/h8-13,17,20,27,30H,3-7,14-16,18-19H2,1-2H3 |
| InChIKey | RZTMMGNCETZNLZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|