C19H25N3OS — CID 171994443
N-cyclopentyl-2-(1-thieno[3,2-c]pyridin-4-ylpiperidin-4-yl)acetamide (PubChem CID 171994443) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is N-cyclopentyl-2-(1-thieno[3,2-c]pyridin-4-ylpiperidin-4-yl)acetamide.
| Compound Name | N-cyclopentyl-2-(1-thieno[3,2-c]pyridin-4-ylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 171994443 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-cyclopentyl-2-(1-thieno[3,2-c]pyridin-4-ylpiperidin-4-yl)acetamide |
| SMILES | O=C(CC1CCN(c2nccc3sccc23)CC1)NC1CCCC1 |
| InChI | InChI=1S/C19H25N3OS/c23-18(21-15-3-1-2-4-15)13-14-6-10-22(11-7-14)19-16-8-12-24-17(16)5-9-20-19/h5,8-9,12,14-15H,1-4,6-7,10-11,13H2,(H,21,23) |
| InChIKey | ANNZGWQGTFNSKZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |