C19H20F2N2O4S — CID 2648529
(2R)-1-(benzenesulfonyl)-N-[4-(difluoromethoxy)phenyl]piperidine-2-carboxamide (PubChem CID 2648529) has the molecular formula C19H20F2N2O4S and a molecular weight of 410.44 g/mol. Its IUPAC name is (2R)-1-(benzenesulfonyl)-N-[4-(difluoromethoxy)phenyl]piperidine-2-carboxamide.
| Compound Name | (2R)-1-(benzenesulfonyl)-N-[4-(difluoromethoxy)phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 2648529 |
| Molecular Formula | C19H20F2N2O4S |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (2R)-1-(benzenesulfonyl)-N-[4-(difluoromethoxy)phenyl]piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)[C@H]1CCCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20F2N2O4S/c20-19(21)27-15-11-9-14(10-12-15)22-18(24)17-8-4-5-13-23(17)28(25,26)16-6-2-1-3-7-16/h1-3,6-7,9-12,17,19H,4-5,8,13H2,(H,22,24)/t17-/m1/s1 |
| InChIKey | NQCKCRFPDHLMFV-QGZVFWFLSA-N |
| XLogP | 3.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |