C18H15BrClN3O3S — CID 43041852
1-(4-bromophenyl)sulfonyl-N-(3-chloro-4-cyanophenyl)pyrrolidine-2-carboxamide (PubChem CID 43041852) has the molecular formula C18H15BrClN3O3S and a molecular weight of 468.76 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-N-(3-chloro-4-cyanophenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-bromophenyl)sulfonyl-N-(3-chloro-4-cyanophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 43041852 |
| Molecular Formula | C18H15BrClN3O3S |
| Molecular Weight | 468.76 g/mol |
| Exact Mass | 466.97 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-N-(3-chloro-4-cyanophenyl)pyrrolidine-2-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)C2CCCN2S(=O)(=O)c2ccc(Br)cc2)cc1Cl |
| InChI | InChI=1S/C18H15BrClN3O3S/c19-13-4-7-15(8-5-13)27(25,26)23-9-1-2-17(23)18(24)22-14-6-3-12(11-21)16(20)10-14/h3-8,10,17H,1-2,9H2,(H,22,24) |
| InChIKey | ZONIUIGDIBVVIO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |