C17H23FN2O5S2 — CID 90586366
[1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]-(4-methylsulfonylpiperidin-1-yl)methanone (PubChem CID 90586366) has the molecular formula C17H23FN2O5S2 and a molecular weight of 418.51 g/mol. Its IUPAC name is [1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]-(4-methylsulfonylpiperidin-1-yl)methanone.
| Compound Name | [1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]-(4-methylsulfonylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 90586366 |
| Molecular Formula | C17H23FN2O5S2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | [1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]-(4-methylsulfonylpiperidin-1-yl)methanone |
| SMILES | CS(=O)(=O)C1CCN(C(=O)C2CCCN2S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H23FN2O5S2/c1-26(22,23)13-8-11-19(12-9-13)17(21)15-6-4-10-20(15)27(24,25)16-7-3-2-5-14(16)18/h2-3,5,7,13,15H,4,6,8-12H2,1H3 |
| InChIKey | UOSPXNPTTUVSKP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |