C15H20FN3O4S — CID 51567796
N-[(2S)-1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]morpholine-4-carboxamide (PubChem CID 51567796) has the molecular formula C15H20FN3O4S and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(2S)-1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2S)-1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 51567796 |
| Molecular Formula | C15H20FN3O4S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[(2S)-1-(2-fluorophenyl)sulfonylpyrrolidin-2-yl]morpholine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCCN1S(=O)(=O)c1ccccc1F)N1CCOCC1 |
| InChI | InChI=1S/C15H20FN3O4S/c16-12-4-1-2-5-13(12)24(21,22)19-7-3-6-14(19)17-15(20)18-8-10-23-11-9-18/h1-2,4-5,14H,3,6-11H2,(H,17,20)/t14-/m0/s1 |
| InChIKey | WFYCTJGQVPETBZ-AWEZNQCLSA-N |
| XLogP | 0.98 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |