C14H14BrN3O4S3 — CID 24665031
1-(5-bromothiophen-2-yl)sulfonyl-N'-(thiophene-2-carbonyl)pyrrolidine-2-carbohydrazide (PubChem CID 24665031) has the molecular formula C14H14BrN3O4S3 and a molecular weight of 464.39 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N'-(thiophene-2-carbonyl)pyrrolidine-2-carbohydrazide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N'-(thiophene-2-carbonyl)pyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 24665031 |
| Molecular Formula | C14H14BrN3O4S3 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 462.93 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N'-(thiophene-2-carbonyl)pyrrolidine-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCN1S(=O)(=O)c1ccc(Br)s1)c1cccs1 |
| InChI | InChI=1S/C14H14BrN3O4S3/c15-11-5-6-12(24-11)25(21,22)18-7-1-3-9(18)13(19)16-17-14(20)10-4-2-8-23-10/h2,4-6,8-9H,1,3,7H2,(H,16,19)(H,17,20) |
| InChIKey | XPYZKHLYRNECPH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|