C15H17N3O3 — CID 66069532
4-(2,3-dihydro-1H-indole-5-carbonyl)-3-ethylpiperazine-2,6-dione (PubChem CID 66069532) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-indole-5-carbonyl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(2,3-dihydro-1H-indole-5-carbonyl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66069532 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-(2,3-dihydro-1H-indole-5-carbonyl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C15H17N3O3/c1-2-12-14(20)17-13(19)8-18(12)15(21)10-3-4-11-9(7-10)5-6-16-11/h3-4,7,12,16H,2,5-6,8H2,1H3,(H,17,19,20) |
| InChIKey | BKQBBGGHPPRFNK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|