C10H11N3O4 — CID 66068922
3-ethyl-4-(1,2-oxazole-5-carbonyl)piperazine-2,6-dione (PubChem CID 66068922) has the molecular formula C10H11N3O4 and a molecular weight of 237.21 g/mol. Its IUPAC name is 3-ethyl-4-(1,2-oxazole-5-carbonyl)piperazine-2,6-dione.
| Compound Name | 3-ethyl-4-(1,2-oxazole-5-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66068922 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 3-ethyl-4-(1,2-oxazole-5-carbonyl)piperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)c1ccno1 |
| InChI | InChI=1S/C10H11N3O4/c1-2-6-9(15)12-8(14)5-13(6)10(16)7-3-4-11-17-7/h3-4,6H,2,5H2,1H3,(H,12,14,15) |
| InChIKey | WXMFOIXPTNSQMU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|