C12H15N5O3 — CID 66067262
3-ethyl-4-(4-hydrazinylpyridine-2-carbonyl)piperazine-2,6-dione (PubChem CID 66067262) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 3-ethyl-4-(4-hydrazinylpyridine-2-carbonyl)piperazine-2,6-dione.
| Compound Name | 3-ethyl-4-(4-hydrazinylpyridine-2-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66067262 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 3-ethyl-4-(4-hydrazinylpyridine-2-carbonyl)piperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)c1cc(NN)ccn1 |
| InChI | InChI=1S/C12H15N5O3/c1-2-9-11(19)15-10(18)6-17(9)12(20)8-5-7(16-13)3-4-14-8/h3-5,9H,2,6,13H2,1H3,(H,14,16)(H,15,18,19) |
| InChIKey | XZGIWBSGKCMZQE-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|