C11H13N5O3 — CID 66076054
4-(4-hydrazinylpyridine-2-carbonyl)-3-methylpiperazine-2,6-dione (PubChem CID 66076054) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-(4-hydrazinylpyridine-2-carbonyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(4-hydrazinylpyridine-2-carbonyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66076054 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 4-(4-hydrazinylpyridine-2-carbonyl)-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)c1cc(NN)ccn1 |
| InChI | InChI=1S/C11H13N5O3/c1-6-10(18)14-9(17)5-16(6)11(19)8-4-7(15-12)2-3-13-8/h2-4,6H,5,12H2,1H3,(H,13,15)(H,14,17,18) |
| InChIKey | BXTFANAKJXOLCP-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|