C12H14N4O3 — CID 81245317
4-(4-aminopyridine-3-carbonyl)-3-ethylpiperazine-2,6-dione (PubChem CID 81245317) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 4-(4-aminopyridine-3-carbonyl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(4-aminopyridine-3-carbonyl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 81245317 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-(4-aminopyridine-3-carbonyl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)c1cnccc1N |
| InChI | InChI=1S/C12H14N4O3/c1-2-9-11(18)15-10(17)6-16(9)12(19)7-5-14-4-3-8(7)13/h3-5,9H,2,6H2,1H3,(H2,13,14)(H,15,17,18) |
| InChIKey | MMWQWLGHLDWEQL-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|