C14H18N4O3 — CID 66067067
3-ethyl-4-(2-hydrazinyl-5-methylbenzoyl)piperazine-2,6-dione (PubChem CID 66067067) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-ethyl-4-(2-hydrazinyl-5-methylbenzoyl)piperazine-2,6-dione.
| Compound Name | 3-ethyl-4-(2-hydrazinyl-5-methylbenzoyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66067067 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 3-ethyl-4-(2-hydrazinyl-5-methylbenzoyl)piperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)c1cc(C)ccc1NN |
| InChI | InChI=1S/C14H18N4O3/c1-3-11-13(20)16-12(19)7-18(11)14(21)9-6-8(2)4-5-10(9)17-15/h4-6,11,17H,3,7,15H2,1-2H3,(H,16,19,20) |
| InChIKey | HTJIYFANBMGJKC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|