C14H19ClN4O2 — CID 63603736
4-[2-chloro-6-(ethylamino)pyridine-4-carbonyl]-3-ethylpiperazin-2-one (PubChem CID 63603736) has the molecular formula C14H19ClN4O2 and a molecular weight of 310.79 g/mol. Its IUPAC name is 4-[2-chloro-6-(ethylamino)pyridine-4-carbonyl]-3-ethylpiperazin-2-one.
| Compound Name | 4-[2-chloro-6-(ethylamino)pyridine-4-carbonyl]-3-ethylpiperazin-2-one |
|---|---|
| PubChem CID | 63603736 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4-[2-chloro-6-(ethylamino)pyridine-4-carbonyl]-3-ethylpiperazin-2-one |
| SMILES | CCNc1cc(C(=O)N2CCNC(=O)C2CC)cc(Cl)n1 |
| InChI | InChI=1S/C14H19ClN4O2/c1-3-10-13(20)17-5-6-19(10)14(21)9-7-11(15)18-12(8-9)16-4-2/h7-8,10H,3-6H2,1-2H3,(H,16,18)(H,17,20) |
| InChIKey | RLUZTCLOHLGWSX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|