C12H17ClN4O — CID 114921648
(2-amino-5-chloro-4-pyridinyl)-(4-ethylpiperazin-1-yl)methanone (PubChem CID 114921648) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is (2-amino-5-chloro-4-pyridinyl)-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | (2-amino-5-chloro-4-pyridinyl)-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 114921648 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (2-amino-5-chloro-4-pyridinyl)-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2cc(N)ncc2Cl)CC1 |
| InChI | InChI=1S/C12H17ClN4O/c1-2-16-3-5-17(6-4-16)12(18)9-7-11(14)15-8-10(9)13/h7-8H,2-6H2,1H3,(H2,14,15) |
| InChIKey | DSVOAVMQSRQGAR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |