C11H14ClN3OS — CID 114924651
(2-amino-5-chloro-4-pyridinyl)-(2-methylthiomorpholin-4-yl)methanone (PubChem CID 114924651) has the molecular formula C11H14ClN3OS and a molecular weight of 271.77 g/mol. Its IUPAC name is (2-amino-5-chloro-4-pyridinyl)-(2-methylthiomorpholin-4-yl)methanone.
| Compound Name | (2-amino-5-chloro-4-pyridinyl)-(2-methylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 114924651 |
| Molecular Formula | C11H14ClN3OS |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | (2-amino-5-chloro-4-pyridinyl)-(2-methylthiomorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2cc(N)ncc2Cl)CCS1 |
| InChI | InChI=1S/C11H14ClN3OS/c1-7-6-15(2-3-17-7)11(16)8-4-10(13)14-5-9(8)12/h4-5,7H,2-3,6H2,1H3,(H2,13,14) |
| InChIKey | VDHZZWKQOUNFCZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |