C12H17ClN4OS — CID 6463586
(5-chloro-2-methylsulfanylpyrimidin-4-yl)-(4-ethylpiperazin-1-yl)methanone (PubChem CID 6463586) has the molecular formula C12H17ClN4OS and a molecular weight of 300.81 g/mol. Its IUPAC name is (5-chloro-2-methylsulfanylpyrimidin-4-yl)-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | (5-chloro-2-methylsulfanylpyrimidin-4-yl)-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 6463586 |
| Molecular Formula | C12H17ClN4OS |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (5-chloro-2-methylsulfanylpyrimidin-4-yl)-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2nc(SC)ncc2Cl)CC1 |
| InChI | InChI=1S/C12H17ClN4OS/c1-3-16-4-6-17(7-5-16)11(18)10-9(13)8-14-12(15-10)19-2/h8H,3-7H2,1-2H3 |
| InChIKey | URYVUJJAHPKBIB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |