C18H21ClN4OS — CID 43047382
(5-chloro-2-methylsulfanylpyrimidin-4-yl)-[4-(2-phenylethyl)piperazin-1-yl]methanone (PubChem CID 43047382) has the molecular formula C18H21ClN4OS and a molecular weight of 376.91 g/mol. Its IUPAC name is (5-chloro-2-methylsulfanylpyrimidin-4-yl)-[4-(2-phenylethyl)piperazin-1-yl]methanone.
| Compound Name | (5-chloro-2-methylsulfanylpyrimidin-4-yl)-[4-(2-phenylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 43047382 |
| Molecular Formula | C18H21ClN4OS |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (5-chloro-2-methylsulfanylpyrimidin-4-yl)-[4-(2-phenylethyl)piperazin-1-yl]methanone |
| SMILES | CSc1ncc(Cl)c(C(=O)N2CCN(CCc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C18H21ClN4OS/c1-25-18-20-13-15(19)16(21-18)17(24)23-11-9-22(10-12-23)8-7-14-5-3-2-4-6-14/h2-6,13H,7-12H2,1H3 |
| InChIKey | JBPLBGBNGKXWEX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |