C13H18ClN3OS — CID 19245711
(5-chloro-2-ethylsulfanylpyrimidin-4-yl)-(4-methylpiperidin-1-yl)methanone (PubChem CID 19245711) has the molecular formula C13H18ClN3OS and a molecular weight of 299.83 g/mol. Its IUPAC name is (5-chloro-2-ethylsulfanylpyrimidin-4-yl)-(4-methylpiperidin-1-yl)methanone.
| Compound Name | (5-chloro-2-ethylsulfanylpyrimidin-4-yl)-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 19245711 |
| Molecular Formula | C13H18ClN3OS |
| Molecular Weight | 299.83 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (5-chloro-2-ethylsulfanylpyrimidin-4-yl)-(4-methylpiperidin-1-yl)methanone |
| SMILES | CCSc1ncc(Cl)c(C(=O)N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C13H18ClN3OS/c1-3-19-13-15-8-10(14)11(16-13)12(18)17-6-4-9(2)5-7-17/h8-9H,3-7H2,1-2H3 |
| InChIKey | TXBNWQFTMIFQIL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.83 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |