C11H14ClN3O2S — CID 62371144
(5-chloro-2-methylsulfanylpyrimidin-4-yl)-[3-(hydroxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 62371144) has the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. Its IUPAC name is (5-chloro-2-methylsulfanylpyrimidin-4-yl)-[3-(hydroxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (5-chloro-2-methylsulfanylpyrimidin-4-yl)-[3-(hydroxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 62371144 |
| Molecular Formula | C11H14ClN3O2S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | (5-chloro-2-methylsulfanylpyrimidin-4-yl)-[3-(hydroxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | CSc1ncc(Cl)c(C(=O)N2CCC(CO)C2)n1 |
| InChI | InChI=1S/C11H14ClN3O2S/c1-18-11-13-4-8(12)9(14-11)10(17)15-3-2-7(5-15)6-16/h4,7,16H,2-3,5-6H2,1H3 |
| InChIKey | GEIYWDGMYKOXJR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |