C13H18ClN3O2S — CID 62467198
(5-chloro-2-methylsulfanylpyrimidin-4-yl)-[2-(3-hydroxypropyl)pyrrolidin-1-yl]methanone (PubChem CID 62467198) has the molecular formula C13H18ClN3O2S and a molecular weight of 315.83 g/mol. Its IUPAC name is (5-chloro-2-methylsulfanylpyrimidin-4-yl)-[2-(3-hydroxypropyl)pyrrolidin-1-yl]methanone.
| Compound Name | (5-chloro-2-methylsulfanylpyrimidin-4-yl)-[2-(3-hydroxypropyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 62467198 |
| Molecular Formula | C13H18ClN3O2S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | (5-chloro-2-methylsulfanylpyrimidin-4-yl)-[2-(3-hydroxypropyl)pyrrolidin-1-yl]methanone |
| SMILES | CSc1ncc(Cl)c(C(=O)N2CCCC2CCCO)n1 |
| InChI | InChI=1S/C13H18ClN3O2S/c1-20-13-15-8-10(14)11(16-13)12(19)17-6-2-4-9(17)5-3-7-18/h8-9,18H,2-7H2,1H3 |
| InChIKey | QNWYHBKFTYQWFX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |