C13H16BrFN2O2 — CID 81096176
(5-amino-2-bromo-4-fluorophenyl)-(4-hydroxy-4-methylpiperidin-1-yl)methanone (PubChem CID 81096176) has the molecular formula C13H16BrFN2O2 and a molecular weight of 331.19 g/mol. Its IUPAC name is (5-amino-2-bromo-4-fluorophenyl)-(4-hydroxy-4-methylpiperidin-1-yl)methanone.
| Compound Name | (5-amino-2-bromo-4-fluorophenyl)-(4-hydroxy-4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 81096176 |
| Molecular Formula | C13H16BrFN2O2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (5-amino-2-bromo-4-fluorophenyl)-(4-hydroxy-4-methylpiperidin-1-yl)methanone |
| SMILES | CC1(O)CCN(C(=O)c2cc(N)c(F)cc2Br)CC1 |
| InChI | InChI=1S/C13H16BrFN2O2/c1-13(19)2-4-17(5-3-13)12(18)8-6-11(16)10(15)7-9(8)14/h6-7,19H,2-5,16H2,1H3 |
| InChIKey | YQTOZMQIVIYHHJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|