C25H31N3O2 — CID 45208229
1-[4-[3-[4-(2-methylphenyl)piperazin-1-yl]piperidine-1-carbonyl]phenyl]ethanone (PubChem CID 45208229) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[4-[3-[4-(2-methylphenyl)piperazin-1-yl]piperidine-1-carbonyl]phenyl]ethanone.
| Compound Name | 1-[4-[3-[4-(2-methylphenyl)piperazin-1-yl]piperidine-1-carbonyl]phenyl]ethanone |
|---|---|
| PubChem CID | 45208229 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 1-[4-[3-[4-(2-methylphenyl)piperazin-1-yl]piperidine-1-carbonyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(C(=O)N2CCCC(N3CCN(c4ccccc4C)CC3)C2)cc1 |
| InChI | InChI=1S/C25H31N3O2/c1-19-6-3-4-8-24(19)27-16-14-26(15-17-27)23-7-5-13-28(18-23)25(30)22-11-9-21(10-12-22)20(2)29/h3-4,6,8-12,23H,5,7,13-18H2,1-2H3 |
| InChIKey | DETJZQXMLAOUAZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |