C23H28BrN3O — CID 92986000
(3-bromophenyl)-[(3S)-3-[4-(2-methylphenyl)piperazin-1-yl]piperidin-1-yl]methanone (PubChem CID 92986000) has the molecular formula C23H28BrN3O and a molecular weight of 442.40 g/mol. Its IUPAC name is (3-bromophenyl)-[(3S)-3-[4-(2-methylphenyl)piperazin-1-yl]piperidin-1-yl]methanone.
| Compound Name | (3-bromophenyl)-[(3S)-3-[4-(2-methylphenyl)piperazin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 92986000 |
| Molecular Formula | C23H28BrN3O |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (3-bromophenyl)-[(3S)-3-[4-(2-methylphenyl)piperazin-1-yl]piperidin-1-yl]methanone |
| SMILES | Cc1ccccc1N1CCN([C@H]2CCCN(C(=O)c3cccc(Br)c3)C2)CC1 |
| InChI | InChI=1S/C23H28BrN3O/c1-18-6-2-3-10-22(18)26-14-12-25(13-15-26)21-9-5-11-27(17-21)23(28)19-7-4-8-20(24)16-19/h2-4,6-8,10,16,21H,5,9,11-15,17H2,1H3/t21-/m0/s1 |
| InChIKey | OBURLRVQIODQMX-NRFANRHFSA-N |
| XLogP | 4.18 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |