C24H29N3O3 — CID 74229736
methyl 3-[3-(4-phenylpiperazin-1-yl)piperidine-1-carbonyl]benzoate (PubChem CID 74229736) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is methyl 3-[3-(4-phenylpiperazin-1-yl)piperidine-1-carbonyl]benzoate.
| Compound Name | methyl 3-[3-(4-phenylpiperazin-1-yl)piperidine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 74229736 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | methyl 3-[3-(4-phenylpiperazin-1-yl)piperidine-1-carbonyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)N2CCCC(N3CCN(c4ccccc4)CC3)C2)c1 |
| InChI | InChI=1S/C24H29N3O3/c1-30-24(29)20-8-5-7-19(17-20)23(28)27-12-6-11-22(18-27)26-15-13-25(14-16-26)21-9-3-2-4-10-21/h2-5,7-10,17,22H,6,11-16,18H2,1H3 |
| InChIKey | DPYSZWIKYWYCMO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |