C25H33N3O4 — CID 45181952
[3-(4-phenylpiperazin-1-yl)piperidin-1-yl]-(2,3,4-trimethoxyphenyl)methanone (PubChem CID 45181952) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is [3-(4-phenylpiperazin-1-yl)piperidin-1-yl]-(2,3,4-trimethoxyphenyl)methanone.
| Compound Name | [3-(4-phenylpiperazin-1-yl)piperidin-1-yl]-(2,3,4-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 45181952 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | [3-(4-phenylpiperazin-1-yl)piperidin-1-yl]-(2,3,4-trimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCCC(N3CCN(c4ccccc4)CC3)C2)c(OC)c1OC |
| InChI | InChI=1S/C25H33N3O4/c1-30-22-12-11-21(23(31-2)24(22)32-3)25(29)28-13-7-10-20(18-28)27-16-14-26(15-17-27)19-8-5-4-6-9-19/h4-6,8-9,11-12,20H,7,10,13-18H2,1-3H3 |
| InChIKey | UGUSTDIJCNGEDP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |