C23H28FN3O2 — CID 45187407
[3-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-(2-methoxyphenyl)methanone (PubChem CID 45187407) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is [3-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-(2-methoxyphenyl)methanone.
| Compound Name | [3-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 45187407 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | [3-[4-(2-fluorophenyl)piperazin-1-yl]piperidin-1-yl]-(2-methoxyphenyl)methanone |
| SMILES | COc1ccccc1C(=O)N1CCCC(N2CCN(c3ccccc3F)CC2)C1 |
| InChI | InChI=1S/C23H28FN3O2/c1-29-22-11-5-2-8-19(22)23(28)27-12-6-7-18(17-27)25-13-15-26(16-14-25)21-10-4-3-9-20(21)24/h2-5,8-11,18H,6-7,12-17H2,1H3 |
| InChIKey | VLHJNXOGFDRDIJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |