C21H26N4O2 — CID 95707922
(3-hydroxy-2-pyridinyl)-[(3S)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]methanone (PubChem CID 95707922) has the molecular formula C21H26N4O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is (3-hydroxy-2-pyridinyl)-[(3S)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]methanone.
| Compound Name | (3-hydroxy-2-pyridinyl)-[(3S)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95707922 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (3-hydroxy-2-pyridinyl)-[(3S)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ncccc1O)N1CCC[C@H](N2CCN(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C21H26N4O2/c26-19-9-4-10-22-20(19)21(27)25-11-5-8-18(16-25)24-14-12-23(13-15-24)17-6-2-1-3-7-17/h1-4,6-7,9-10,18,26H,5,8,11-16H2/t18-/m0/s1 |
| InChIKey | UZPMIXGIXDAFAY-SFHVURJKSA-N |
| XLogP | 2.21 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |