C23H30N4O — CID 125179316
(3S)-N-[4-(2-methylphenyl)phenyl]-3-(4-methylpiperazin-1-yl)pyrrolidine-1-carboxamide (PubChem CID 125179316) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is (3S)-N-[4-(2-methylphenyl)phenyl]-3-(4-methylpiperazin-1-yl)pyrrolidine-1-carboxamide.
| Compound Name | (3S)-N-[4-(2-methylphenyl)phenyl]-3-(4-methylpiperazin-1-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 125179316 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (3S)-N-[4-(2-methylphenyl)phenyl]-3-(4-methylpiperazin-1-yl)pyrrolidine-1-carboxamide |
| SMILES | Cc1ccccc1-c1ccc(NC(=O)N2CC[C@H](N3CCN(C)CC3)C2)cc1 |
| InChI | InChI=1S/C23H30N4O/c1-18-5-3-4-6-22(18)19-7-9-20(10-8-19)24-23(28)27-12-11-21(17-27)26-15-13-25(2)14-16-26/h3-10,21H,11-17H2,1-2H3,(H,24,28)/t21-/m0/s1 |
| InChIKey | YUBYZGCUNNDNFJ-NRFANRHFSA-N |
| XLogP | 3.52 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |