C12H15N3O4S — CID 35795642
N-[4-(3-oxopiperazine-1-carbonyl)phenyl]methanesulfonamide (PubChem CID 35795642) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-[4-(3-oxopiperazine-1-carbonyl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(3-oxopiperazine-1-carbonyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 35795642 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[4-(3-oxopiperazine-1-carbonyl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)N2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C12H15N3O4S/c1-20(18,19)14-10-4-2-9(3-5-10)12(17)15-7-6-13-11(16)8-15/h2-5,14H,6-8H2,1H3,(H,13,16) |
| InChIKey | GGTNGTYLLLESJX-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |