C13H16N4O3 — CID 62896644
[4-(3-oxo-1,4-diazepane-1-carbonyl)phenyl]urea (PubChem CID 62896644) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is [4-(3-oxo-1,4-diazepane-1-carbonyl)phenyl]urea.
| Compound Name | [4-(3-oxo-1,4-diazepane-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 62896644 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | [4-(3-oxo-1,4-diazepane-1-carbonyl)phenyl]urea |
| SMILES | NC(=O)Nc1ccc(C(=O)N2CCCNC(=O)C2)cc1 |
| InChI | InChI=1S/C13H16N4O3/c14-13(20)16-10-4-2-9(3-5-10)12(19)17-7-1-6-15-11(18)8-17/h2-5H,1,6-8H2,(H,15,18)(H3,14,16,20) |
| InChIKey | JUTADSVJIXAMCX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |