C15H16N4O3 — CID 125433756
4-[4-[(5-oxo-1,2-dihydropyrrol-3-yl)amino]benzoyl]piperazin-2-one (PubChem CID 125433756) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 4-[4-[(5-oxo-1,2-dihydropyrrol-3-yl)amino]benzoyl]piperazin-2-one.
| Compound Name | 4-[4-[(5-oxo-1,2-dihydropyrrol-3-yl)amino]benzoyl]piperazin-2-one |
|---|---|
| PubChem CID | 125433756 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 4-[4-[(5-oxo-1,2-dihydropyrrol-3-yl)amino]benzoyl]piperazin-2-one |
| SMILES | O=C1C=C(Nc2ccc(C(=O)N3CCNC(=O)C3)cc2)CN1 |
| InChI | InChI=1S/C15H16N4O3/c20-13-7-12(8-17-13)18-11-3-1-10(2-4-11)15(22)19-6-5-16-14(21)9-19/h1-4,7,18H,5-6,8-9H2,(H,16,21)(H,17,20) |
| InChIKey | HGUQHUNWKLNYHI-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |