C32H40N2O2 — CID 23283049
N-[1-(cyclooctylmethyl)piperidin-4-yl]-2,7-bis(ethenyl)-9H-xanthene-9-carboxamide (PubChem CID 23283049) has the molecular formula C32H40N2O2 and a molecular weight of 484.68 g/mol. Its IUPAC name is N-[1-(cyclooctylmethyl)piperidin-4-yl]-2,7-bis(ethenyl)-9H-xanthene-9-carboxamide.
| Compound Name | N-[1-(cyclooctylmethyl)piperidin-4-yl]-2,7-bis(ethenyl)-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 23283049 |
| Molecular Formula | C32H40N2O2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | N-[1-(cyclooctylmethyl)piperidin-4-yl]-2,7-bis(ethenyl)-9H-xanthene-9-carboxamide |
| SMILES | C=Cc1ccc2c(c1)C(C(=O)NC1CCN(CC3CCCCCCC3)CC1)c1cc(C=C)ccc1O2 |
| InChI | InChI=1S/C32H40N2O2/c1-3-23-12-14-29-27(20-23)31(28-21-24(4-2)13-15-30(28)36-29)32(35)33-26-16-18-34(19-17-26)22-25-10-8-6-5-7-9-11-25/h3-4,12-15,20-21,25-26,31H,1-2,5-11,16-19,22H2,(H,33,35) |
| InChIKey | KGQIIELBRXDGBA-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |