C28H33Br2IN2O2 — CID 70341930
2,7-dibromo-N-[1-(cyclooctylmethyl)piperidin-4-yl]-9-iodoxanthene-9-carboxamide (PubChem CID 70341930) has the molecular formula C28H33Br2IN2O2 and a molecular weight of 716.30 g/mol. Its IUPAC name is 2,7-dibromo-N-[1-(cyclooctylmethyl)piperidin-4-yl]-9-iodoxanthene-9-carboxamide.
| Compound Name | 2,7-dibromo-N-[1-(cyclooctylmethyl)piperidin-4-yl]-9-iodoxanthene-9-carboxamide |
|---|---|
| PubChem CID | 70341930 |
| Molecular Formula | C28H33Br2IN2O2 |
| Molecular Weight | 716.30 g/mol |
| Exact Mass | 714.00 |
| IUPAC Name | 2,7-dibromo-N-[1-(cyclooctylmethyl)piperidin-4-yl]-9-iodoxanthene-9-carboxamide |
| SMILES | O=C(NC1CCN(CC2CCCCCCC2)CC1)C1(I)c2cc(Br)ccc2Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C28H33Br2IN2O2/c29-20-8-10-25-23(16-20)28(31,24-17-21(30)9-11-26(24)35-25)27(34)32-22-12-14-33(15-13-22)18-19-6-4-2-1-3-5-7-19/h8-11,16-17,19,22H,1-7,12-15,18H2,(H,32,34) |
| InChIKey | PGKMSIAHLKXYNF-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.30 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|