C21H29BrN2O — CID 47083546
1-(4-bromophenyl)-N-[1-(cyclopentylmethyl)piperidin-4-yl]cyclopropane-1-carboxamide (PubChem CID 47083546) has the molecular formula C21H29BrN2O and a molecular weight of 405.38 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[1-(cyclopentylmethyl)piperidin-4-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[1-(cyclopentylmethyl)piperidin-4-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 47083546 |
| Molecular Formula | C21H29BrN2O |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1-(4-bromophenyl)-N-[1-(cyclopentylmethyl)piperidin-4-yl]cyclopropane-1-carboxamide |
| SMILES | O=C(NC1CCN(CC2CCCC2)CC1)C1(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C21H29BrN2O/c22-18-7-5-17(6-8-18)21(11-12-21)20(25)23-19-9-13-24(14-10-19)15-16-3-1-2-4-16/h5-8,16,19H,1-4,9-15H2,(H,23,25) |
| InChIKey | SVWKBHIITVDRNX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |