C16H20BrNO2 — CID 103751443
1-(4-bromophenyl)-N-[2-(hydroxymethyl)cyclopentyl]cyclopropane-1-carboxamide (PubChem CID 103751443) has the molecular formula C16H20BrNO2 and a molecular weight of 338.25 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[2-(hydroxymethyl)cyclopentyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[2-(hydroxymethyl)cyclopentyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 103751443 |
| Molecular Formula | C16H20BrNO2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-(4-bromophenyl)-N-[2-(hydroxymethyl)cyclopentyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NC1CCCC1CO)C1(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C16H20BrNO2/c17-13-6-4-12(5-7-13)16(8-9-16)15(20)18-14-3-1-2-11(14)10-19/h4-7,11,14,19H,1-3,8-10H2,(H,18,20) |
| InChIKey | NJYIEDFDHCQVMK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |