C23H28ClNO2 — CID 143174173
benzene;1-(4-chlorophenyl)-N-[2-(hydroxymethyl)cyclohexyl]cyclopropane-1-carboxamide (PubChem CID 143174173) has the molecular formula C23H28ClNO2 and a molecular weight of 385.94 g/mol. Its IUPAC name is benzene;1-(4-chlorophenyl)-N-[2-(hydroxymethyl)cyclohexyl]cyclopropane-1-carboxamide.
| Compound Name | benzene;1-(4-chlorophenyl)-N-[2-(hydroxymethyl)cyclohexyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 143174173 |
| Molecular Formula | C23H28ClNO2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | benzene;1-(4-chlorophenyl)-N-[2-(hydroxymethyl)cyclohexyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NC1CCCCC1CO)C1(c2ccc(Cl)cc2)CC1.c1ccccc1 |
| InChI | InChI=1S/C17H22ClNO2.C6H6/c18-14-7-5-13(6-8-14)17(9-10-17)16(21)19-15-4-2-1-3-12(15)11-20;1-2-4-6-5-3-1/h5-8,12,15,20H,1-4,9-11H2,(H,19,21);1-6H |
| InChIKey | RNZNEOXQHIHUJJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |