C19H35N3O2 — CID 111104143
1-[1-(cyclohexylmethyl)piperidin-4-yl]-3-[(1-hydroxycyclopentyl)methyl]urea (PubChem CID 111104143) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is 1-[1-(cyclohexylmethyl)piperidin-4-yl]-3-[(1-hydroxycyclopentyl)methyl]urea.
| Compound Name | 1-[1-(cyclohexylmethyl)piperidin-4-yl]-3-[(1-hydroxycyclopentyl)methyl]urea |
|---|---|
| PubChem CID | 111104143 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | 1-[1-(cyclohexylmethyl)piperidin-4-yl]-3-[(1-hydroxycyclopentyl)methyl]urea |
| SMILES | O=C(NCC1(O)CCCC1)NC1CCN(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C19H35N3O2/c23-18(20-15-19(24)10-4-5-11-19)21-17-8-12-22(13-9-17)14-16-6-2-1-3-7-16/h16-17,24H,1-15H2,(H2,20,21,23) |
| InChIKey | WLNLMXVLFKJVNK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |