C17H33N3O2 — CID 110936693
1-[(1-hydroxycyclohexyl)methyl]-3-[(1-propylpiperidin-4-yl)methyl]urea (PubChem CID 110936693) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is 1-[(1-hydroxycyclohexyl)methyl]-3-[(1-propylpiperidin-4-yl)methyl]urea.
| Compound Name | 1-[(1-hydroxycyclohexyl)methyl]-3-[(1-propylpiperidin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 110936693 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 1-[(1-hydroxycyclohexyl)methyl]-3-[(1-propylpiperidin-4-yl)methyl]urea |
| SMILES | CCCN1CCC(CNC(=O)NCC2(O)CCCCC2)CC1 |
| InChI | InChI=1S/C17H33N3O2/c1-2-10-20-11-6-15(7-12-20)13-18-16(21)19-14-17(22)8-4-3-5-9-17/h15,22H,2-14H2,1H3,(H2,18,19,21) |
| InChIKey | BEIMCVFEYFBZKW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |